About 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene
4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene (PubChem CID 141200512) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene.
Molecular Properties
| Compound Name | 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene |
| PubChem CID | 141200512 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene |
| SMILES | CC(C)(C)OCc1ccc(C(C)(C)C)cc1COC(C)(C)C |
| InChI | InChI=1S/C20H34O2/c1-18(2,3)17-11-10-15(13-21-19(4,5)6)16(12-17)14-22-20(7,8)9/h10-12H,13-14H2,1-9H3 |
| InChIKey | BWZMYHDXACIXNC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene?
The IUPAC name of 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene (CID 141200512) is 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene.
What is the SMILES notation for 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene?
The canonical SMILES for 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene is CC(C)(C)OCc1ccc(C(C)(C)C)cc1COC(C)(C)C.
What is the InChIKey of 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene?
The InChIKey is BWZMYHDXACIXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2/c1-18(2,3)17-11-10-15(13-21-19(4,5)6)16(12-17)14-22-20(7,8)9/h10-12H,13-14H2,1-9H3.
What are the key properties of 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene?
4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene has a molecular weight of 306.49 g/mol, XLogP of 5.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,2-bis[(2-methylpropan-2-yl)oxymethyl]benzene is sourced from PubChem (CID 141200512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).