C11H16N2O — CID 141201313
2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine (PubChem CID 141201313) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine.
| Compound Name | 2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 141201313 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-[[(2R)-1-methylpyrrolidin-2-yl]methoxy]pyridine |
| SMILES | CN1CCC[C@@H]1COc1ccccn1 |
| InChI | InChI=1S/C11H16N2O/c1-13-8-4-5-10(13)9-14-11-6-2-3-7-12-11/h2-3,6-7,10H,4-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | FVYOREQUPSCRIR-SNVBAGLBSA-N |
| XLogP | 1.55 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |