About 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide
3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide (PubChem CID 141201361) has the molecular formula C15H12N2O2
and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide.
Molecular Properties
| Compound Name | 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide |
| PubChem CID | 141201361 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide |
| SMILES | NC(=O)C1NC(=O)c2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C15H12N2O2/c16-14(18)13-11-8-4-7-10(12(11)15(19)17-13)9-5-2-1-3-6-9/h1-8,13H,(H2,16,18)(H,17,19) |
| InChIKey | NNXKHXDKOCPWOT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide?
The IUPAC name of 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide (CID 141201361) is 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide.
What is the SMILES notation for 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide?
The canonical SMILES for 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide is NC(=O)C1NC(=O)c2c(-c3ccccc3)cccc21.
What is the InChIKey of 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide?
The InChIKey is NNXKHXDKOCPWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2/c16-14(18)13-11-8-4-7-10(12(11)15(19)17-13)9-5-2-1-3-6-9/h1-8,13H,(H2,16,18)(H,17,19).
What are the key properties of 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide?
3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide has a molecular weight of 252.27 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-4-phenyl-1,2-dihydroisoindole-1-carboxamide is sourced from PubChem (CID 141201361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).