C9H9NO2 — CID 141202603
6,7-dihydro-1H-3,1-benzoxazepin-2-one (PubChem CID 141202603) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 6,7-dihydro-1H-3,1-benzoxazepin-2-one.
| Compound Name | 6,7-dihydro-1H-3,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 141202603 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 6,7-dihydro-1H-3,1-benzoxazepin-2-one |
| SMILES | O=C1NC2=C(C=CO1)CCC=C2 |
| InChI | InChI=1S/C9H9NO2/c11-9-10-8-4-2-1-3-7(8)5-6-12-9/h2,4-6H,1,3H2,(H,10,11) |
| InChIKey | LGNIXXRUJFMPFC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |