C20H20ClFN4O2 — CID 141202671
5-chloro-4-N-[2-fluoro-6-(3-phenylmethoxypropoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 141202671) has the molecular formula C20H20ClFN4O2 and a molecular weight of 402.86 g/mol. Its IUPAC name is 5-chloro-4-N-[2-fluoro-6-(3-phenylmethoxypropoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-[2-fluoro-6-(3-phenylmethoxypropoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141202671 |
| Molecular Formula | C20H20ClFN4O2 |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 5-chloro-4-N-[2-fluoro-6-(3-phenylmethoxypropoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cl)c(Nc2c(F)cccc2OCCCOCc2ccccc2)n1 |
| InChI | InChI=1S/C20H20ClFN4O2/c21-15-12-24-20(23)26-19(15)25-18-16(22)8-4-9-17(18)28-11-5-10-27-13-14-6-2-1-3-7-14/h1-4,6-9,12H,5,10-11,13H2,(H3,23,24,25,26) |
| InChIKey | PMRWTVFBZJSRNG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|