About 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol
6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol (PubChem CID 141202677) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol.
Molecular Properties
| Compound Name | 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol |
| PubChem CID | 141202677 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol |
| SMILES | CCN1CC(O)(CO)COc2cccc(N)c21 |
| InChI | InChI=1S/C12H18N2O3/c1-2-14-6-12(16,7-15)8-17-10-5-3-4-9(13)11(10)14/h3-5,15-16H,2,6-8,13H2,1H3 |
| InChIKey | LJOJGUSDZIQDFH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol?
The IUPAC name of 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol (CID 141202677) is 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol.
What is the SMILES notation for 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol?
The canonical SMILES for 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol is CCN1CC(O)(CO)COc2cccc(N)c21.
What is the InChIKey of 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol?
The InChIKey is LJOJGUSDZIQDFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-2-14-6-12(16,7-15)8-17-10-5-3-4-9(13)11(10)14/h3-5,15-16H,2,6-8,13H2,1H3.
What are the key properties of 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol?
6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol has a molecular weight of 238.29 g/mol, XLogP of 0.21, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-ethyl-3-(hydroxymethyl)-2,4-dihydro-1,5-benzoxazepin-3-ol is sourced from PubChem (CID 141202677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).