C15H18ClN5O2S — CID 141202772
5-chloro-N-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrimidin-4-amine (PubChem CID 141202772) has the molecular formula C15H18ClN5O2S and a molecular weight of 367.86 g/mol. Its IUPAC name is 5-chloro-N-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 141202772 |
| Molecular Formula | C15H18ClN5O2S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-chloro-N-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrimidin-4-amine |
| SMILES | CN1CCN(S(=O)(=O)c2ccccc2Nc2ncncc2Cl)CC1 |
| InChI | InChI=1S/C15H18ClN5O2S/c1-20-6-8-21(9-7-20)24(22,23)14-5-3-2-4-13(14)19-15-12(16)10-17-11-18-15/h2-5,10-11H,6-9H2,1H3,(H,17,18,19) |
| InChIKey | NVDHXGLYJWZIFS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |