About [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol
[4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol (PubChem CID 141203510) has the molecular formula C20H18BrF2NO2
and a molecular weight of 422.27 g/mol. Its IUPAC name is [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol |
| PubChem CID | 141203510 |
| Molecular Formula | C20H18BrF2NO2 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol |
| SMILES | CC1=CC(OCc2ccc(F)cc2F)=C(Br)CN1c1ccc(CO)cc1 |
| InChI | InChI=1S/C20H18BrF2NO2/c1-13-8-20(26-12-15-4-5-16(22)9-19(15)23)18(21)10-24(13)17-6-2-14(11-25)3-7-17/h2-9,25H,10-12H2,1H3 |
| InChIKey | KSUKBZYTEJCTNX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol?
The IUPAC name of [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol (CID 141203510) is [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol.
What is the SMILES notation for [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol?
The canonical SMILES for [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol is CC1=CC(OCc2ccc(F)cc2F)=C(Br)CN1c1ccc(CO)cc1.
What is the InChIKey of [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol?
The InChIKey is KSUKBZYTEJCTNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BrF2NO2/c1-13-8-20(26-12-15-4-5-16(22)9-19(15)23)18(21)10-24(13)17-6-2-14(11-25)3-7-17/h2-9,25H,10-12H2,1H3.
What are the key properties of [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol?
[4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol has a molecular weight of 422.27 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2H-pyridin-1-yl]phenyl]methanol is sourced from PubChem (CID 141203510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).