C18H22ClN3O3S — CID 141203751
(3S)-4-[6-[2-(4-chlorophenyl)sulfonylpropan-2-yl]pyrimidin-4-yl]-3-methylmorpholine (PubChem CID 141203751) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is (3S)-4-[6-[2-(4-chlorophenyl)sulfonylpropan-2-yl]pyrimidin-4-yl]-3-methylmorpholine.
| Compound Name | (3S)-4-[6-[2-(4-chlorophenyl)sulfonylpropan-2-yl]pyrimidin-4-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 141203751 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (3S)-4-[6-[2-(4-chlorophenyl)sulfonylpropan-2-yl]pyrimidin-4-yl]-3-methylmorpholine |
| SMILES | C[C@H]1COCCN1c1cc(C(C)(C)S(=O)(=O)c2ccc(Cl)cc2)ncn1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-13-11-25-9-8-22(13)17-10-16(20-12-21-17)18(2,3)26(23,24)15-6-4-14(19)5-7-15/h4-7,10,12-13H,8-9,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | OJSHGQRXHBPQIW-ZDUSSCGKSA-N |
| XLogP | 3.06 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |