About 3-[2,3-bis(trifluoromethyl)phenyl]furan
3-[2,3-bis(trifluoromethyl)phenyl]furan (PubChem CID 141204161) has the molecular formula C12H6F6O
and a molecular weight of 280.17 g/mol. Its IUPAC name is 3-[2,3-bis(trifluoromethyl)phenyl]furan.
Molecular Properties
| Compound Name | 3-[2,3-bis(trifluoromethyl)phenyl]furan |
| PubChem CID | 141204161 |
| Molecular Formula | C12H6F6O |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-[2,3-bis(trifluoromethyl)phenyl]furan |
| SMILES | FC(F)(F)c1cccc(-c2ccoc2)c1C(F)(F)F |
| InChI | InChI=1S/C12H6F6O/c13-11(14,15)9-3-1-2-8(7-4-5-19-6-7)10(9)12(16,17)18/h1-6H |
| InChIKey | GUHSRFFSVKDHDA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2,3-bis(trifluoromethyl)phenyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-bis(trifluoromethyl)phenyl]furan?
The IUPAC name of 3-[2,3-bis(trifluoromethyl)phenyl]furan (CID 141204161) is 3-[2,3-bis(trifluoromethyl)phenyl]furan.
What is the SMILES notation for 3-[2,3-bis(trifluoromethyl)phenyl]furan?
The canonical SMILES for 3-[2,3-bis(trifluoromethyl)phenyl]furan is FC(F)(F)c1cccc(-c2ccoc2)c1C(F)(F)F.
What is the InChIKey of 3-[2,3-bis(trifluoromethyl)phenyl]furan?
The InChIKey is GUHSRFFSVKDHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F6O/c13-11(14,15)9-3-1-2-8(7-4-5-19-6-7)10(9)12(16,17)18/h1-6H.
What are the key properties of 3-[2,3-bis(trifluoromethyl)phenyl]furan?
3-[2,3-bis(trifluoromethyl)phenyl]furan has a molecular weight of 280.17 g/mol, XLogP of 4.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-bis(trifluoromethyl)phenyl]furan is sourced from PubChem (CID 141204161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).