About 3H-dioxazolo[4,5-b]pyridine
3H-dioxazolo[4,5-b]pyridine (PubChem CID 141204226) has the molecular formula C5H4N2O2
and a molecular weight of 124.10 g/mol. Its IUPAC name is 3H-dioxazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3H-dioxazolo[4,5-b]pyridine |
| PubChem CID | 141204226 |
| Molecular Formula | C5H4N2O2 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 3H-dioxazolo[4,5-b]pyridine |
| SMILES | c1cnc2c(c1)OON2 |
| InChI | InChI=1S/C5H4N2O2/c1-2-4-5(6-3-1)7-9-8-4/h1-3H,(H,6,7) |
| InChIKey | OWWPTBKNQYFWHG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3H-dioxazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dioxazolo[4,5-b]pyridine?
The IUPAC name of 3H-dioxazolo[4,5-b]pyridine (CID 141204226) is 3H-dioxazolo[4,5-b]pyridine.
What is the SMILES notation for 3H-dioxazolo[4,5-b]pyridine?
The canonical SMILES for 3H-dioxazolo[4,5-b]pyridine is c1cnc2c(c1)OON2.
What is the InChIKey of 3H-dioxazolo[4,5-b]pyridine?
The InChIKey is OWWPTBKNQYFWHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2/c1-2-4-5(6-3-1)7-9-8-4/h1-3H,(H,6,7).
What are the key properties of 3H-dioxazolo[4,5-b]pyridine?
3H-dioxazolo[4,5-b]pyridine has a molecular weight of 124.10 g/mol, XLogP of 0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dioxazolo[4,5-b]pyridine is sourced from PubChem (CID 141204226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).