About 5-methyl-4,6-diphenyl-1H-pyridin-2-one
5-methyl-4,6-diphenyl-1H-pyridin-2-one (PubChem CID 14120548) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-methyl-4,6-diphenyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-methyl-4,6-diphenyl-1H-pyridin-2-one |
| PubChem CID | 14120548 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 5-methyl-4,6-diphenyl-1H-pyridin-2-one |
| SMILES | Cc1c(-c2ccccc2)cc(=O)[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C18H15NO/c1-13-16(14-8-4-2-5-9-14)12-17(20)19-18(13)15-10-6-3-7-11-15/h2-12H,1H3,(H,19,20) |
| InChIKey | ITJQDQXUAFENGE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-4,6-diphenyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,6-diphenyl-1H-pyridin-2-one?
The IUPAC name of 5-methyl-4,6-diphenyl-1H-pyridin-2-one (CID 14120548) is 5-methyl-4,6-diphenyl-1H-pyridin-2-one.
What is the SMILES notation for 5-methyl-4,6-diphenyl-1H-pyridin-2-one?
The canonical SMILES for 5-methyl-4,6-diphenyl-1H-pyridin-2-one is Cc1c(-c2ccccc2)cc(=O)[nH]c1-c1ccccc1.
What is the InChIKey of 5-methyl-4,6-diphenyl-1H-pyridin-2-one?
The InChIKey is ITJQDQXUAFENGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO/c1-13-16(14-8-4-2-5-9-14)12-17(20)19-18(13)15-10-6-3-7-11-15/h2-12H,1H3,(H,19,20).
What are the key properties of 5-methyl-4,6-diphenyl-1H-pyridin-2-one?
5-methyl-4,6-diphenyl-1H-pyridin-2-one has a molecular weight of 261.32 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,6-diphenyl-1H-pyridin-2-one is sourced from PubChem (CID 14120548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).