C16H11F21 — CID 141205616
6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoro-3-methylpentadec-2-ene (PubChem CID 141205616) has the molecular formula C16H11F21 and a molecular weight of 602.22 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoro-3-methylpentadec-2-ene.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoro-3-methylpentadec-2-ene |
|---|---|
| PubChem CID | 141205616 |
| Molecular Formula | C16H11F21 |
| Molecular Weight | 602.22 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoro-3-methylpentadec-2-ene |
| SMILES | CC=C(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H11F21/c1-3-6(2)4-5-7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)15(33,34)16(35,36)37/h3H,4-5H2,1-2H3 |
| InChIKey | MBCVRYDLLDKTFS-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.22 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|