About 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione
4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione (PubChem CID 141206395) has the molecular formula C13H7Cl3N2OS
and a molecular weight of 345.64 g/mol. Its IUPAC name is 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 141206395 |
| Molecular Formula | C13H7Cl3N2OS |
| Molecular Weight | 345.64 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione |
| SMILES | S=c1[nH]c2ccc(Oc3cccc(Cl)c3Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C13H7Cl3N2OS/c14-6-2-1-3-8(10(6)15)19-9-5-4-7-12(11(9)16)18-13(20)17-7/h1-5H,(H2,17,18,20) |
| InChIKey | SEDZAKGGKXTVIZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione (CID 141206395) is 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione is S=c1[nH]c2ccc(Oc3cccc(Cl)c3Cl)c(Cl)c2[nH]1.
What is the InChIKey of 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is SEDZAKGGKXTVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl3N2OS/c14-6-2-1-3-8(10(6)15)19-9-5-4-7-12(11(9)16)18-13(20)17-7/h1-5H,(H2,17,18,20).
What are the key properties of 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione?
4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 345.64 g/mol, XLogP of 5.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 141206395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).