About methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate
methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 141206795) has the molecular formula C12H16O6
and a molecular weight of 256.25 g/mol. Its IUPAC name is methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 141206795 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(OC)C(O)(C(C)=O)C(OC)=C1 |
| InChI | InChI=1S/C12H16O6/c1-7(13)12(15)9(16-2)5-8(11(14)18-4)6-10(12)17-3/h5-6,9,15H,1-4H3 |
| InChIKey | JJKGRFXUEZJTEX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate (CID 141206795) is methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=CC(OC)C(O)(C(C)=O)C(OC)=C1.
What is the InChIKey of methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is JJKGRFXUEZJTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O6/c1-7(13)12(15)9(16-2)5-8(11(14)18-4)6-10(12)17-3/h5-6,9,15H,1-4H3.
What are the key properties of methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate?
methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 256.25 g/mol, XLogP of -0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-acetyl-4-hydroxy-3,5-dimethoxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 141206795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).