About methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate
methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate (PubChem CID 141207077) has the molecular formula C12H17F3O3
and a molecular weight of 266.26 g/mol. Its IUPAC name is methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate.
Molecular Properties
| Compound Name | methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate |
| PubChem CID | 141207077 |
| Molecular Formula | C12H17F3O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate |
| SMILES | COC(=O)CCCCC(=C=O)C(CF)(CF)CF |
| InChI | InChI=1S/C12H17F3O3/c1-18-11(17)5-3-2-4-10(6-16)12(7-13,8-14)9-15/h2-5,7-9H2,1H3 |
| InChIKey | MGWKMWBBUYJEGF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate?
The IUPAC name of methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate (CID 141207077) is methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate.
What is the SMILES notation for methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate?
The canonical SMILES for methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate is COC(=O)CCCCC(=C=O)C(CF)(CF)CF.
What is the InChIKey of methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate?
The InChIKey is MGWKMWBBUYJEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3O3/c1-18-11(17)5-3-2-4-10(6-16)12(7-13,8-14)9-15/h2-5,7-9H2,1H3.
What are the key properties of methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate?
methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate has a molecular weight of 266.26 g/mol, XLogP of 2.37, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-fluoro-7,7-bis(fluoromethyl)-6-(oxomethylidene)octanoate is sourced from PubChem (CID 141207077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).