C22H29N3OS — CID 141207981
N-cyclohexyl-2-cyclohexylsulfanyl-6-pyrrol-1-ylpyridine-3-carboxamide (PubChem CID 141207981) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is N-cyclohexyl-2-cyclohexylsulfanyl-6-pyrrol-1-ylpyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-2-cyclohexylsulfanyl-6-pyrrol-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 141207981 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-cyclohexyl-2-cyclohexylsulfanyl-6-pyrrol-1-ylpyridine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(-n2cccc2)nc1SC1CCCCC1 |
| InChI | InChI=1S/C22H29N3OS/c26-21(23-17-9-3-1-4-10-17)19-13-14-20(25-15-7-8-16-25)24-22(19)27-18-11-5-2-6-12-18/h7-8,13-18H,1-6,9-12H2,(H,23,26) |
| InChIKey | UNKCJIGCIVZSFJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |