C18H22O4 — CID 141208093
3-(5,8-dimethyl-3,3a,4,5a,6,7-hexahydro-1H-benzo[e][2]benzofuran-5-yl)oxolane-2,5-dione (PubChem CID 141208093) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-(5,8-dimethyl-3,3a,4,5a,6,7-hexahydro-1H-benzo[e][2]benzofuran-5-yl)oxolane-2,5-dione.
| Compound Name | 3-(5,8-dimethyl-3,3a,4,5a,6,7-hexahydro-1H-benzo[e][2]benzofuran-5-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 141208093 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-(5,8-dimethyl-3,3a,4,5a,6,7-hexahydro-1H-benzo[e][2]benzofuran-5-yl)oxolane-2,5-dione |
| SMILES | CC1=CC2=C3COCC3CC(C)(C3CC(=O)OC3=O)C2CC1 |
| InChI | InChI=1S/C18H22O4/c1-10-3-4-14-12(5-10)13-9-21-8-11(13)7-18(14,2)15-6-16(19)22-17(15)20/h5,11,14-15H,3-4,6-9H2,1-2H3 |
| InChIKey | ZORDQJBDIFBVHU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|