About 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol
2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol (PubChem CID 141208350) has the molecular formula C13H17F4NO
and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol |
| PubChem CID | 141208350 |
| Molecular Formula | C13H17F4NO |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol |
| SMILES | CC(C)(CC(O)(CN)C(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C13H17F4NO/c1-11(2,9-4-3-5-10(14)6-9)7-12(19,8-18)13(15,16)17/h3-6,19H,7-8,18H2,1-2H3 |
| InChIKey | WOQDRDXTZZNEOX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol?
The IUPAC name of 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol (CID 141208350) is 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol.
What is the SMILES notation for 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol?
The canonical SMILES for 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol is CC(C)(CC(O)(CN)C(F)(F)F)c1cccc(F)c1.
What is the InChIKey of 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol?
The InChIKey is WOQDRDXTZZNEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F4NO/c1-11(2,9-4-3-5-10(14)6-9)7-12(19,8-18)13(15,16)17/h3-6,19H,7-8,18H2,1-2H3.
What are the key properties of 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol?
2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol has a molecular weight of 279.28 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1,1,1-trifluoro-4-(3-fluorophenyl)-4-methylpentan-2-ol is sourced from PubChem (CID 141208350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).