C15H25N5 — CID 141209103
N-ethyl-5-octyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 141209103) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is N-ethyl-5-octyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-ethyl-5-octyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 141209103 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | N-ethyl-5-octyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCCCCc1cc(NCC)n2ncnc2n1 |
| InChI | InChI=1S/C15H25N5/c1-3-5-6-7-8-9-10-13-11-14(16-4-2)20-15(19-13)17-12-18-20/h11-12,16H,3-10H2,1-2H3 |
| InChIKey | NVXREDSXJLWJDQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|