About 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole
5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole (PubChem CID 141209515) has the molecular formula C32H22F2N2O2S
and a molecular weight of 536.60 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole.
Molecular Properties
| Compound Name | 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole |
| PubChem CID | 141209515 |
| Molecular Formula | C32H22F2N2O2S |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)c1ccc2c(cnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H22F2N2O2S/c33-27-19-28(34)21-30(20-27)39(37,38)29-16-17-31-23(18-29)22-35-36(31)32(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-22H |
| InChIKey | TZLNPMOPBRKNQE-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole?
The IUPAC name of 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole (CID 141209515) is 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole.
What is the SMILES notation for 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole?
The canonical SMILES for 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole is O=S(=O)(c1cc(F)cc(F)c1)c1ccc2c(cnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole?
The InChIKey is TZLNPMOPBRKNQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H22F2N2O2S/c33-27-19-28(34)21-30(20-27)39(37,38)29-16-17-31-23(18-29)22-35-36(31)32(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-22H.
What are the key properties of 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole?
5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole has a molecular weight of 536.60 g/mol, XLogP of 6.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-difluorophenyl)sulfonyl-1-tritylindazole is sourced from PubChem (CID 141209515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).