C16H15NO2 — CID 141210941
2-(2,3-dimethylphenyl)-3-hydroxy-3H-isoindol-1-one (PubChem CID 141210941) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-3-hydroxy-3H-isoindol-1-one.
| Compound Name | 2-(2,3-dimethylphenyl)-3-hydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 141210941 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-3-hydroxy-3H-isoindol-1-one |
| SMILES | Cc1cccc(N2C(=O)c3ccccc3C2O)c1C |
| InChI | InChI=1S/C16H15NO2/c1-10-6-5-9-14(11(10)2)17-15(18)12-7-3-4-8-13(12)16(17)19/h3-9,15,18H,1-2H3 |
| InChIKey | UCZMNPQQHVVAOF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |