C16H20FN3O — CID 141211537
1-[2-[(3S,4R)-4-amino-3-fluoropiperidin-1-yl]ethyl]quinolin-2-one (PubChem CID 141211537) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-[2-[(3S,4R)-4-amino-3-fluoropiperidin-1-yl]ethyl]quinolin-2-one.
| Compound Name | 1-[2-[(3S,4R)-4-amino-3-fluoropiperidin-1-yl]ethyl]quinolin-2-one |
|---|---|
| PubChem CID | 141211537 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-[2-[(3S,4R)-4-amino-3-fluoropiperidin-1-yl]ethyl]quinolin-2-one |
| SMILES | N[C@@H]1CCN(CCn2c(=O)ccc3ccccc32)C[C@@H]1F |
| InChI | InChI=1S/C16H20FN3O/c17-13-11-19(8-7-14(13)18)9-10-20-15-4-2-1-3-12(15)5-6-16(20)21/h1-6,13-14H,7-11,18H2/t13-,14+/m0/s1 |
| InChIKey | JXPMQWJBCLGQBQ-UONOGXRCSA-N |
| XLogP | 1.37 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |