About 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine
1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 141212767) has the molecular formula C20H17N5
and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine |
| PubChem CID | 141212767 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | c1ccc(Nc2ncc3cnn(C4CCc5ccccc54)c3n2)cc1 |
| InChI | InChI=1S/C20H17N5/c1-2-7-16(8-3-1)23-20-21-12-15-13-22-25(19(15)24-20)18-11-10-14-6-4-5-9-17(14)18/h1-9,12-13,18H,10-11H2,(H,21,23,24) |
| InChIKey | ILJASNREBWTFNT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
The IUPAC name of 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine (CID 141212767) is 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine.
What is the SMILES notation for 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
The canonical SMILES for 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine is c1ccc(Nc2ncc3cnn(C4CCc5ccccc54)c3n2)cc1.
What is the InChIKey of 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
The InChIKey is ILJASNREBWTFNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5/c1-2-7-16(8-3-1)23-20-21-12-15-13-22-25(19(15)24-20)18-11-10-14-6-4-5-9-17(14)18/h1-9,12-13,18H,10-11H2,(H,21,23,24).
What are the key properties of 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine?
1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine has a molecular weight of 327.39 g/mol, XLogP of 4.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-inden-1-yl)-N-phenylpyrazolo[3,4-d]pyrimidin-6-amine is sourced from PubChem (CID 141212767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).