About 4H-indole-5-sulfonic acid
4H-indole-5-sulfonic acid (PubChem CID 141212952) has the molecular formula C8H7NO3S
and a molecular weight of 197.22 g/mol. Its IUPAC name is 4H-indole-5-sulfonic acid.
Molecular Properties
| Compound Name | 4H-indole-5-sulfonic acid |
| PubChem CID | 141212952 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4H-indole-5-sulfonic acid |
| SMILES | O=S(=O)(O)C1=CC=C2N=CC=C2C1 |
| InChI | InChI=1S/C8H7NO3S/c10-13(11,12)7-1-2-8-6(5-7)3-4-9-8/h1-4H,5H2,(H,10,11,12) |
| InChIKey | NIJAWQLLKHJSJF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4H-indole-5-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-indole-5-sulfonic acid?
The IUPAC name of 4H-indole-5-sulfonic acid (CID 141212952) is 4H-indole-5-sulfonic acid.
What is the SMILES notation for 4H-indole-5-sulfonic acid?
The canonical SMILES for 4H-indole-5-sulfonic acid is O=S(=O)(O)C1=CC=C2N=CC=C2C1.
What is the InChIKey of 4H-indole-5-sulfonic acid?
The InChIKey is NIJAWQLLKHJSJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S/c10-13(11,12)7-1-2-8-6(5-7)3-4-9-8/h1-4H,5H2,(H,10,11,12).
What are the key properties of 4H-indole-5-sulfonic acid?
4H-indole-5-sulfonic acid has a molecular weight of 197.22 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-indole-5-sulfonic acid is sourced from PubChem (CID 141212952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).