C6H10BF8N — CID 141212968
pyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide (PubChem CID 141212968) has the molecular formula C6H10BF8N and a molecular weight of 258.95 g/mol. Its IUPAC name is pyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide.
| Compound Name | pyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
|---|---|
| PubChem CID | 141212968 |
| Molecular Formula | C6H10BF8N |
| Molecular Weight | 258.95 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | pyrrolidin-1-ium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
| SMILES | C1CC[NH2+]C1.F[B-](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H9N.C2BF8/c1-2-4-5-3-1;4-1(5,2(6,7)8)3(9,10)11/h5H,1-4H2;/q;-1/p+1 |
| InChIKey | RFGZQCTVJZZCKH-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.95 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|