C15H17NO — CID 141213114
(3aS,6aS)-2-[(1R)-1-phenylethyl]-1,3a,4,6a-tetrahydrocyclopenta[c]pyrrol-3-one (PubChem CID 141213114) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (3aS,6aS)-2-[(1R)-1-phenylethyl]-1,3a,4,6a-tetrahydrocyclopenta[c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-2-[(1R)-1-phenylethyl]-1,3a,4,6a-tetrahydrocyclopenta[c]pyrrol-3-one |
|---|---|
| PubChem CID | 141213114 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (3aS,6aS)-2-[(1R)-1-phenylethyl]-1,3a,4,6a-tetrahydrocyclopenta[c]pyrrol-3-one |
| SMILES | C[C@H](c1ccccc1)N1C[C@H]2C=CC[C@@H]2C1=O |
| InChI | InChI=1S/C15H17NO/c1-11(12-6-3-2-4-7-12)16-10-13-8-5-9-14(13)15(16)17/h2-8,11,13-14H,9-10H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | WOSCYGKPCFTEKV-BNOWGMLFSA-N |
| XLogP | 2.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|