About 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine
6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine (PubChem CID 141213781) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine |
| PubChem CID | 141213781 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine |
| SMILES | Cc1cc(-c2ncno2)cc(NC(C)C)n1 |
| InChI | InChI=1S/C11H14N4O/c1-7(2)14-10-5-9(4-8(3)15-10)11-12-6-13-16-11/h4-7H,1-3H3,(H,14,15) |
| InChIKey | NGRWIGRUICUQAT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine?
The IUPAC name of 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine (CID 141213781) is 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine.
What is the SMILES notation for 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine?
The canonical SMILES for 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine is Cc1cc(-c2ncno2)cc(NC(C)C)n1.
What is the InChIKey of 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine?
The InChIKey is NGRWIGRUICUQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c1-7(2)14-10-5-9(4-8(3)15-10)11-12-6-13-16-11/h4-7H,1-3H3,(H,14,15).
What are the key properties of 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine?
6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine has a molecular weight of 218.26 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-(1,2,4-oxadiazol-5-yl)-N-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 141213781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).