C23H36OS — CID 141214089
(1Z,3E,5E,7E,9E,11E)-2-methylsulfanyldocosa-1,3,5,7,9,11-hexaen-1-ol (PubChem CID 141214089) has the molecular formula C23H36OS and a molecular weight of 360.61 g/mol. Its IUPAC name is (1Z,3E,5E,7E,9E,11E)-2-methylsulfanyldocosa-1,3,5,7,9,11-hexaen-1-ol.
| Compound Name | (1Z,3E,5E,7E,9E,11E)-2-methylsulfanyldocosa-1,3,5,7,9,11-hexaen-1-ol |
|---|---|
| PubChem CID | 141214089 |
| Molecular Formula | C23H36OS |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (1Z,3E,5E,7E,9E,11E)-2-methylsulfanyldocosa-1,3,5,7,9,11-hexaen-1-ol |
| SMILES | CCCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C(=C/O)SC |
| InChI | InChI=1S/C23H36OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(22-24)25-2/h12-22,24H,3-11H2,1-2H3/b13-12+,15-14+,17-16+,19-18+,21-20+,23-22- |
| InChIKey | SGLTZGYFYOMPHI-PFZXASDVSA-N |
| XLogP | 8.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|