About 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol
1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol (PubChem CID 141214112) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol.
Molecular Properties
| Compound Name | 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol |
| PubChem CID | 141214112 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol |
| SMILES | C#CCN1C(O)C=CN(CC)C1O |
| InChI | InChI=1S/C9H14N2O2/c1-3-6-11-8(12)5-7-10(4-2)9(11)13/h1,5,7-9,12-13H,4,6H2,2H3 |
| InChIKey | DFNVYHLDTKEMAC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol?
The IUPAC name of 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol (CID 141214112) is 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol.
What is the SMILES notation for 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol?
The canonical SMILES for 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol is C#CCN1C(O)C=CN(CC)C1O.
What is the InChIKey of 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol?
The InChIKey is DFNVYHLDTKEMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-3-6-11-8(12)5-7-10(4-2)9(11)13/h1,5,7-9,12-13H,4,6H2,2H3.
What are the key properties of 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol?
1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol has a molecular weight of 182.22 g/mol, XLogP of -0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-prop-2-ynyl-2,4-dihydropyrimidine-2,4-diol is sourced from PubChem (CID 141214112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).