About hexyl 3-amino-2-oxopentanoate
hexyl 3-amino-2-oxopentanoate (PubChem CID 141214219) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is hexyl 3-amino-2-oxopentanoate.
Molecular Properties
| Compound Name | hexyl 3-amino-2-oxopentanoate |
| PubChem CID | 141214219 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | hexyl 3-amino-2-oxopentanoate |
| SMILES | CCCCCCOC(=O)C(=O)C(N)CC |
| InChI | InChI=1S/C11H21NO3/c1-3-5-6-7-8-15-11(14)10(13)9(12)4-2/h9H,3-8,12H2,1-2H3 |
| InChIKey | QRFPMGVHGQXNAE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze hexyl 3-amino-2-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 3-amino-2-oxopentanoate?
The IUPAC name of hexyl 3-amino-2-oxopentanoate (CID 141214219) is hexyl 3-amino-2-oxopentanoate.
What is the SMILES notation for hexyl 3-amino-2-oxopentanoate?
The canonical SMILES for hexyl 3-amino-2-oxopentanoate is CCCCCCOC(=O)C(=O)C(N)CC.
What is the InChIKey of hexyl 3-amino-2-oxopentanoate?
The InChIKey is QRFPMGVHGQXNAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-3-5-6-7-8-15-11(14)10(13)9(12)4-2/h9H,3-8,12H2,1-2H3.
What are the key properties of hexyl 3-amino-2-oxopentanoate?
hexyl 3-amino-2-oxopentanoate has a molecular weight of 215.29 g/mol, XLogP of 1.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 3-amino-2-oxopentanoate is sourced from PubChem (CID 141214219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).