C24H23NO2S — CID 141214506
(4S)-4-benzhydryl-3-(2-phenylsulfanylethyl)-1,3-oxazolidin-2-one (PubChem CID 141214506) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is (4S)-4-benzhydryl-3-(2-phenylsulfanylethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzhydryl-3-(2-phenylsulfanylethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141214506 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (4S)-4-benzhydryl-3-(2-phenylsulfanylethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](C(c2ccccc2)c2ccccc2)N1CCSc1ccccc1 |
| InChI | InChI=1S/C24H23NO2S/c26-24-25(16-17-28-21-14-8-3-9-15-21)22(18-27-24)23(19-10-4-1-5-11-19)20-12-6-2-7-13-20/h1-15,22-23H,16-18H2/t22-/m1/s1 |
| InChIKey | ZSEULAZBPDSPDA-JOCHJYFZSA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |