About 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione
1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 141214765) has the molecular formula C20H14FN3O2
and a molecular weight of 347.35 g/mol. Its IUPAC name is 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| PubChem CID | 141214765 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2cccc(Cc3ccccc3)c2)c2ncc(F)cc12 |
| InChI | InChI=1S/C20H14FN3O2/c21-15-11-17-18(22-12-15)24(20(26)23-19(17)25)16-8-4-7-14(10-16)9-13-5-2-1-3-6-13/h1-8,10-12H,9H2,(H,23,25,26) |
| InChIKey | JQFNRQVCWFTNIK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione?
The IUPAC name of 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (CID 141214765) is 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
What is the SMILES notation for 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione?
The canonical SMILES for 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione is O=c1[nH]c(=O)n(-c2cccc(Cc3ccccc3)c2)c2ncc(F)cc12.
What is the InChIKey of 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione?
The InChIKey is JQFNRQVCWFTNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FN3O2/c21-15-11-17-18(22-12-15)24(20(26)23-19(17)25)16-8-4-7-14(10-16)9-13-5-2-1-3-6-13/h1-8,10-12H,9H2,(H,23,25,26).
What are the key properties of 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione?
1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione has a molecular weight of 347.35 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-benzylphenyl)-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione is sourced from PubChem (CID 141214765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).