About 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol
4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol (PubChem CID 141214888) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol.
Molecular Properties
| Compound Name | 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol |
| PubChem CID | 141214888 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol |
| SMILES | CCCCC1=C(c2ccc(O)cc2)CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C18H20N2O/c1-2-3-6-17-16(14-8-10-15(21)11-9-14)13-20-12-5-4-7-18(20)19-17/h4-5,7-12,21H,2-3,6,13H2,1H3 |
| InChIKey | XFEHCLPUIFNSHI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol?
The IUPAC name of 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol (CID 141214888) is 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol.
What is the SMILES notation for 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol?
The canonical SMILES for 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol is CCCCC1=C(c2ccc(O)cc2)CN2C=CC=CC2=N1.
What is the InChIKey of 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol?
The InChIKey is XFEHCLPUIFNSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O/c1-2-3-6-17-16(14-8-10-15(21)11-9-14)13-20-12-5-4-7-18(20)19-17/h4-5,7-12,21H,2-3,6,13H2,1H3.
What are the key properties of 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol?
4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol has a molecular weight of 280.37 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-butyl-4H-pyrido[1,2-a]pyrimidin-3-yl)phenol is sourced from PubChem (CID 141214888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).