About 1,5-dihydroxyindol-6-olate
1,5-dihydroxyindol-6-olate (PubChem CID 141214938) has the molecular formula C8H6NO3-
and a molecular weight of 164.14 g/mol. Its IUPAC name is 1,5-dihydroxyindol-6-olate.
Molecular Properties
| Compound Name | 1,5-dihydroxyindol-6-olate |
| PubChem CID | 141214938 |
| Molecular Formula | C8H6NO3- |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 1,5-dihydroxyindol-6-olate |
| SMILES | [O-]c1cc2c(ccn2O)cc1O |
| InChI | InChI=1S/C8H7NO3/c10-7-3-5-1-2-9(12)6(5)4-8(7)11/h1-4,10-12H/p-1 |
| InChIKey | RJCMROWGXQCQQI-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dihydroxyindol-6-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydroxyindol-6-olate?
The IUPAC name of 1,5-dihydroxyindol-6-olate (CID 141214938) is 1,5-dihydroxyindol-6-olate.
What is the SMILES notation for 1,5-dihydroxyindol-6-olate?
The canonical SMILES for 1,5-dihydroxyindol-6-olate is [O-]c1cc2c(ccn2O)cc1O.
What is the InChIKey of 1,5-dihydroxyindol-6-olate?
The InChIKey is RJCMROWGXQCQQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NO3/c10-7-3-5-1-2-9(12)6(5)4-8(7)11/h1-4,10-12H/p-1.
What are the key properties of 1,5-dihydroxyindol-6-olate?
1,5-dihydroxyindol-6-olate has a molecular weight of 164.14 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydroxyindol-6-olate is sourced from PubChem (CID 141214938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).