C23H26O8S — CID 14121496
bis(2-methylpropyl) 2-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 14121496) has the molecular formula C23H26O8S and a molecular weight of 462.52 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 2-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 14121496 |
| Molecular Formula | C23H26O8S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | bis(2-methylpropyl) 2-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(C(=O)OCC(C)C)C(=O)C=C(C(=O)OCC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C23H26O8S/c1-13(2)11-30-22(26)17-10-18(24)19(23(27)31-12-14(3)4)21(20(17)25)32(28,29)16-8-6-15(5)7-9-16/h6-10,13-14H,11-12H2,1-5H3 |
| InChIKey | GKTBFJRCZQOIRA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|