C13H16N6 — CID 141215033
5-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine (PubChem CID 141215033) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is 5-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine.
| Compound Name | 5-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 141215033 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 5-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccc(N3CCNCC3)nc2)cn1 |
| InChI | InChI=1S/C13H16N6/c14-13-17-8-11(9-18-13)10-1-2-12(16-7-10)19-5-3-15-4-6-19/h1-2,7-9,15H,3-6H2,(H2,14,17,18) |
| InChIKey | ROGYCEZHXKQAGF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |