C36H74S — CID 141216735
3-tert-butyl-3-(3-tert-butyl-2,2-dimethyldodecan-3-yl)sulfanyl-2,2-dimethyldodecane (PubChem CID 141216735) has the molecular formula C36H74S and a molecular weight of 539.06 g/mol. Its IUPAC name is 3-tert-butyl-3-(3-tert-butyl-2,2-dimethyldodecan-3-yl)sulfanyl-2,2-dimethyldodecane.
| Compound Name | 3-tert-butyl-3-(3-tert-butyl-2,2-dimethyldodecan-3-yl)sulfanyl-2,2-dimethyldodecane |
|---|---|
| PubChem CID | 141216735 |
| Molecular Formula | C36H74S |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.55 |
| IUPAC Name | 3-tert-butyl-3-(3-tert-butyl-2,2-dimethyldodecan-3-yl)sulfanyl-2,2-dimethyldodecane |
| SMILES | CCCCCCCCCC(SC(CCCCCCCCC)(C(C)(C)C)C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H74S/c1-15-17-19-21-23-25-27-29-35(31(3,4)5,32(6,7)8)37-36(33(9,10)11,34(12,13)14)30-28-26-24-22-20-18-16-2/h15-30H2,1-14H3 |
| InChIKey | BOEDBARPTCRUOA-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|