About ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate
ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate (PubChem CID 141216761) has the molecular formula C14H12F6N2O2
and a molecular weight of 354.25 g/mol. Its IUPAC name is ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate |
| PubChem CID | 141216761 |
| Molecular Formula | C14H12F6N2O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)C(=[N+]=[N-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1CC |
| InChI | InChI=1S/C14H12F6N2O2/c1-3-8-9(11(22-21)12(23)24-4-2)5-7(13(15,16)17)6-10(8)14(18,19)20/h5-6H,3-4H2,1-2H3 |
| InChIKey | JCIGRMOIEGDZAH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate?
The IUPAC name of ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate (CID 141216761) is ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate.
What is the SMILES notation for ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate?
The canonical SMILES for ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate is CCOC(=O)C(=[N+]=[N-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1CC.
What is the InChIKey of ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate?
The InChIKey is JCIGRMOIEGDZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F6N2O2/c1-3-8-9(11(22-21)12(23)24-4-2)5-7(13(15,16)17)6-10(8)14(18,19)20/h5-6H,3-4H2,1-2H3.
What are the key properties of ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate?
ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate has a molecular weight of 354.25 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-diazo-2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]acetate is sourced from PubChem (CID 141216761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).