C6H8ClNO2 — CID 141216845
(2Z)-2-[(E)-3-chloroprop-2-enoxy]iminopropanal (PubChem CID 141216845) has the molecular formula C6H8ClNO2 and a molecular weight of 161.59 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-chloroprop-2-enoxy]iminopropanal.
| Compound Name | (2Z)-2-[(E)-3-chloroprop-2-enoxy]iminopropanal |
|---|---|
| PubChem CID | 141216845 |
| Molecular Formula | C6H8ClNO2 |
| Molecular Weight | 161.59 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | (2Z)-2-[(E)-3-chloroprop-2-enoxy]iminopropanal |
| SMILES | C/C(C=O)=N/OC/C=C/Cl |
| InChI | InChI=1S/C6H8ClNO2/c1-6(5-9)8-10-4-2-3-7/h2-3,5H,4H2,1H3/b3-2+,8-6- |
| InChIKey | LJSLATMDDMHCDP-CYFJSKJZSA-N |
| XLogP | 1.33 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|