About N,N-diethyl-4,4-dimethoxybut-1-en-2-amine
N,N-diethyl-4,4-dimethoxybut-1-en-2-amine (PubChem CID 141218047) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is N,N-diethyl-4,4-dimethoxybut-1-en-2-amine.
Molecular Properties
| Compound Name | N,N-diethyl-4,4-dimethoxybut-1-en-2-amine |
| PubChem CID | 141218047 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | N,N-diethyl-4,4-dimethoxybut-1-en-2-amine |
| SMILES | C=C(CC(OC)OC)N(CC)CC |
| InChI | InChI=1S/C10H21NO2/c1-6-11(7-2)9(3)8-10(12-4)13-5/h10H,3,6-8H2,1-2,4-5H3 |
| InChIKey | ZGYUNORMOKBFRC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-4,4-dimethoxybut-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4,4-dimethoxybut-1-en-2-amine?
The IUPAC name of N,N-diethyl-4,4-dimethoxybut-1-en-2-amine (CID 141218047) is N,N-diethyl-4,4-dimethoxybut-1-en-2-amine.
What is the SMILES notation for N,N-diethyl-4,4-dimethoxybut-1-en-2-amine?
The canonical SMILES for N,N-diethyl-4,4-dimethoxybut-1-en-2-amine is C=C(CC(OC)OC)N(CC)CC.
What is the InChIKey of N,N-diethyl-4,4-dimethoxybut-1-en-2-amine?
The InChIKey is ZGYUNORMOKBFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-6-11(7-2)9(3)8-10(12-4)13-5/h10H,3,6-8H2,1-2,4-5H3.
What are the key properties of N,N-diethyl-4,4-dimethoxybut-1-en-2-amine?
N,N-diethyl-4,4-dimethoxybut-1-en-2-amine has a molecular weight of 187.28 g/mol, XLogP of 1.85, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4,4-dimethoxybut-1-en-2-amine is sourced from PubChem (CID 141218047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).