C5H8O2S2 — CID 141218175
[4-(hydroxymethyl)-1,3-dithiol-2-yl]methanol (PubChem CID 141218175) has the molecular formula C5H8O2S2 and a molecular weight of 164.25 g/mol. Its IUPAC name is [4-(hydroxymethyl)-1,3-dithiol-2-yl]methanol.
| Compound Name | [4-(hydroxymethyl)-1,3-dithiol-2-yl]methanol |
|---|---|
| PubChem CID | 141218175 |
| Molecular Formula | C5H8O2S2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | [4-(hydroxymethyl)-1,3-dithiol-2-yl]methanol |
| SMILES | OCC1=CSC(CO)S1 |
| InChI | InChI=1S/C5H8O2S2/c6-1-4-3-8-5(2-7)9-4/h3,5-7H,1-2H2 |
| InChIKey | DYIOEMDDPQXZRH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |