About 1-bromo-2-ethyl-3,4-dimethylbenzene
1-bromo-2-ethyl-3,4-dimethylbenzene (PubChem CID 141218396) has the molecular formula C10H13Br
and a molecular weight of 213.12 g/mol. Its IUPAC name is 1-bromo-2-ethyl-3,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-ethyl-3,4-dimethylbenzene |
| PubChem CID | 141218396 |
| Molecular Formula | C10H13Br |
| Molecular Weight | 213.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1-bromo-2-ethyl-3,4-dimethylbenzene |
| SMILES | CCc1c(Br)ccc(C)c1C |
| InChI | InChI=1S/C10H13Br/c1-4-9-8(3)7(2)5-6-10(9)11/h5-6H,4H2,1-3H3 |
| InChIKey | FOQYJQKJGSLYAQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-ethyl-3,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-ethyl-3,4-dimethylbenzene?
The IUPAC name of 1-bromo-2-ethyl-3,4-dimethylbenzene (CID 141218396) is 1-bromo-2-ethyl-3,4-dimethylbenzene.
What is the SMILES notation for 1-bromo-2-ethyl-3,4-dimethylbenzene?
The canonical SMILES for 1-bromo-2-ethyl-3,4-dimethylbenzene is CCc1c(Br)ccc(C)c1C.
What is the InChIKey of 1-bromo-2-ethyl-3,4-dimethylbenzene?
The InChIKey is FOQYJQKJGSLYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Br/c1-4-9-8(3)7(2)5-6-10(9)11/h5-6H,4H2,1-3H3.
What are the key properties of 1-bromo-2-ethyl-3,4-dimethylbenzene?
1-bromo-2-ethyl-3,4-dimethylbenzene has a molecular weight of 213.12 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-ethyl-3,4-dimethylbenzene is sourced from PubChem (CID 141218396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).