About 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide
2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide (PubChem CID 141218610) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide.
Molecular Properties
| Compound Name | 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide |
| PubChem CID | 141218610 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide |
| SMILES | CNC(=O)C(CC(=O)N(C)C)C12C=CC(CC1)C2 |
| InChI | InChI=1S/C14H22N2O2/c1-15-13(18)11(8-12(17)16(2)3)14-6-4-10(9-14)5-7-14/h4,6,10-11H,5,7-9H2,1-3H3,(H,15,18) |
| InChIKey | SQQMZCZLRQLBMN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide?
The IUPAC name of 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide (CID 141218610) is 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide.
What is the SMILES notation for 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide?
The canonical SMILES for 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide is CNC(=O)C(CC(=O)N(C)C)C12C=CC(CC1)C2.
What is the InChIKey of 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide?
The InChIKey is SQQMZCZLRQLBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-15-13(18)11(8-12(17)16(2)3)14-6-4-10(9-14)5-7-14/h4,6,10-11H,5,7-9H2,1-3H3,(H,15,18).
What are the key properties of 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide?
2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide has a molecular weight of 250.34 g/mol, XLogP of 1.18, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-bicyclo[2.2.1]hept-2-enyl)-N,N',N'-trimethylbutanediamide is sourced from PubChem (CID 141218610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).