C22H24O2 — CID 141218778
tricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaene-7,12-dione (PubChem CID 141218778) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is tricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaene-7,12-dione.
| Compound Name | tricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaene-7,12-dione |
|---|---|
| PubChem CID | 141218778 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | tricyclo[15.3.1.12,6]docosa-1(20),2(22),3,5,17(21),18-hexaene-7,12-dione |
| SMILES | O=C1CCCCC(=O)c2cccc(c2)-c2cccc(c2)CCCC1 |
| InChI | InChI=1S/C22H24O2/c23-21-12-2-1-7-17-8-5-9-18(15-17)19-10-6-11-20(16-19)22(24)14-4-3-13-21/h5-6,8-11,15-16H,1-4,7,12-14H2 |
| InChIKey | UBCPHXPPOINTER-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |