About 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid
5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid (PubChem CID 141218811) has the molecular formula C19H17N3O3S
and a molecular weight of 367.43 g/mol. Its IUPAC name is 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid |
| PubChem CID | 141218811 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(-c2cc(Sc3cccc(O)c3)nc(N)n2)cc1C(=O)O |
| InChI | InChI=1S/C19H17N3O3S/c1-10-6-11(2)15(18(24)25)8-14(10)16-9-17(22-19(20)21-16)26-13-5-3-4-12(23)7-13/h3-9,23H,1-2H3,(H,24,25)(H2,20,21,22) |
| InChIKey | KSIHTAALOTYDOY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid?
The IUPAC name of 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid (CID 141218811) is 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid.
What is the SMILES notation for 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid?
The canonical SMILES for 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid is Cc1cc(C)c(-c2cc(Sc3cccc(O)c3)nc(N)n2)cc1C(=O)O.
What is the InChIKey of 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid?
The InChIKey is KSIHTAALOTYDOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3S/c1-10-6-11(2)15(18(24)25)8-14(10)16-9-17(22-19(20)21-16)26-13-5-3-4-12(23)7-13/h3-9,23H,1-2H3,(H,24,25)(H2,20,21,22).
What are the key properties of 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid?
5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid has a molecular weight of 367.43 g/mol, XLogP of 3.90, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-amino-6-(3-hydroxyphenyl)sulfanylpyrimidin-4-yl]-2,4-dimethylbenzoic acid is sourced from PubChem (CID 141218811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).