About 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one
7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one (PubChem CID 141219304) has the molecular formula C23H13F2N3O
and a molecular weight of 385.37 g/mol. Its IUPAC name is 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one.
Molecular Properties
| Compound Name | 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one |
| PubChem CID | 141219304 |
| Molecular Formula | C23H13F2N3O |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one |
| SMILES | O=C1C(c2ccccc2)=Nc2c(-c3ccc(F)cc3F)c(-c3ccccc3)nn21 |
| InChI | InChI=1S/C23H13F2N3O/c24-16-11-12-17(18(25)13-16)19-20(14-7-3-1-4-8-14)27-28-22(19)26-21(23(28)29)15-9-5-2-6-10-15/h1-13H |
| InChIKey | XCNYISZFYQCPOZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one?
The IUPAC name of 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one (CID 141219304) is 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one.
What is the SMILES notation for 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one?
The canonical SMILES for 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one is O=C1C(c2ccccc2)=Nc2c(-c3ccc(F)cc3F)c(-c3ccccc3)nn21.
What is the InChIKey of 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one?
The InChIKey is XCNYISZFYQCPOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13F2N3O/c24-16-11-12-17(18(25)13-16)19-20(14-7-3-1-4-8-14)27-28-22(19)26-21(23(28)29)15-9-5-2-6-10-15/h1-13H.
What are the key properties of 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one?
7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one has a molecular weight of 385.37 g/mol, XLogP of 5.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,4-difluorophenyl)-2,6-diphenylimidazo[2,1-e]pyrazol-3-one is sourced from PubChem (CID 141219304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).