C15H18F16O3Si — CID 141219356
dimethoxy-propyl-[2,3,3,4,4,5,5,6,7,7,8,8,8-tridecafluoro-6-methyl-2-(trifluoromethyl)octoxy]silane (PubChem CID 141219356) has the molecular formula C15H18F16O3Si and a molecular weight of 578.36 g/mol. Its IUPAC name is dimethoxy-propyl-[2,3,3,4,4,5,5,6,7,7,8,8,8-tridecafluoro-6-methyl-2-(trifluoromethyl)octoxy]silane.
| Compound Name | dimethoxy-propyl-[2,3,3,4,4,5,5,6,7,7,8,8,8-tridecafluoro-6-methyl-2-(trifluoromethyl)octoxy]silane |
|---|---|
| PubChem CID | 141219356 |
| Molecular Formula | C15H18F16O3Si |
| Molecular Weight | 578.36 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | dimethoxy-propyl-[2,3,3,4,4,5,5,6,7,7,8,8,8-tridecafluoro-6-methyl-2-(trifluoromethyl)octoxy]silane |
| SMILES | CCC[Si](OC)(OC)OCC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H18F16O3Si/c1-5-6-35(32-3,33-4)34-7-9(17,14(26,27)28)12(22,23)13(24,25)10(18,19)8(2,16)11(20,21)15(29,30)31/h5-7H2,1-4H3 |
| InChIKey | DYBDOCMGYURHRO-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.36 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|