C17H22O — CID 141219702
2-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-5-prop-2-ynylfuran (PubChem CID 141219702) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-5-prop-2-ynylfuran.
| Compound Name | 2-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-5-prop-2-ynylfuran |
|---|---|
| PubChem CID | 141219702 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-5-prop-2-ynylfuran |
| SMILES | C#CCc1ccc(C[C@@H]2[C@@H](C=C(C)C)C2(C)C)o1 |
| InChI | InChI=1S/C17H22O/c1-6-7-13-8-9-14(18-13)11-16-15(10-12(2)3)17(16,4)5/h1,8-10,15-16H,7,11H2,2-5H3/t15-,16-/m1/s1 |
| InChIKey | YGIIRKLWZIYIPS-HZPDHXFCSA-N |
| XLogP | 4.24 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|