About (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile
(1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile (PubChem CID 141220259) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile.
Molecular Properties
| Compound Name | (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile |
| PubChem CID | 141220259 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile |
| SMILES | N#CC1[C@H]2CN(C#N)C[C@@H]12 |
| InChI | InChI=1S/C7H7N3/c8-1-5-6-2-10(4-9)3-7(5)6/h5-7H,2-3H2/t5?,6-,7+ |
| InChIKey | QXNLKUWFFWRXLB-DGUCWDHESA-N |
| XLogP | 0.17 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile?
The IUPAC name of (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile (CID 141220259) is (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile.
What is the SMILES notation for (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile?
The canonical SMILES for (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile is N#CC1[C@H]2CN(C#N)C[C@@H]12.
What is the InChIKey of (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile?
The InChIKey is QXNLKUWFFWRXLB-DGUCWDHESA-N. The full InChI is InChI=1S/C7H7N3/c8-1-5-6-2-10(4-9)3-7(5)6/h5-7H,2-3H2/t5?,6-,7+.
What are the key properties of (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile?
(1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile has a molecular weight of 133.15 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-3-azabicyclo[3.1.0]hexane-3,6-dicarbonitrile is sourced from PubChem (CID 141220259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).